Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Dimethyl 5-aminoisophthalate, 98%
CAS: 99-27-4 Molecular Formula: C10H11NO4 Molecular Weight (g/mol): 209.201 MDL Number: MFCD00008435 InChI Key: DEKPYXUDJRABNK-UHFFFAOYSA-N PubChem CID: 66831 IUPAC Name: dimethyl 5-aminobenzene-1,3-dicarboxylate SMILES: COC(=O)C1=CC(=CC(=C1)N)C(=O)OC
| PubChem CID | 66831 |
|---|---|
| CAS | 99-27-4 |
| Molecular Weight (g/mol) | 209.201 |
| MDL Number | MFCD00008435 |
| SMILES | COC(=O)C1=CC(=CC(=C1)N)C(=O)OC |
| IUPAC Name | dimethyl 5-aminobenzene-1,3-dicarboxylate |
| InChI Key | DEKPYXUDJRABNK-UHFFFAOYSA-N |
| Molecular Formula | C10H11NO4 |
Tetrabutylammonium hydroxide, 40 wt.% (1.5M) solution in water
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9950g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 38 to 42% (Total base) |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Boiling Point | >100.0°C |
| Color | White to Yellow |
| Physical Form | Crystals or Powder |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.995 |
Borane-tert-butylamine complex, 95%, powder
CAS: 7337-45-3 Molecular Formula: C4H14BN Molecular Weight (g/mol): 86.97 MDL Number: MFCD00075635 InChI Key: GKFJEDWZQZKYHV-UHFFFAOYSA-N Synonym: tert-butylamine borane,borane-tert-butylamine complex,borane tert-butylamine complex,borane-tert-butylaminecomplex,c4h14bn,borane t-butylamine,t-butylamine.borane,tert-butylamineborane,borane tert-butylamine,tert-butylamine-borane PubChem CID: 6364547 IUPAC Name: boron;2-methylpropan-2-amine SMILES: B.CC(C)(C)N
| PubChem CID | 6364547 |
|---|---|
| CAS | 7337-45-3 |
| Molecular Weight (g/mol) | 86.97 |
| MDL Number | MFCD00075635 |
| SMILES | B.CC(C)(C)N |
| Synonym | tert-butylamine borane,borane-tert-butylamine complex,borane tert-butylamine complex,borane-tert-butylaminecomplex,c4h14bn,borane t-butylamine,t-butylamine.borane,tert-butylamineborane,borane tert-butylamine,tert-butylamine-borane |
| IUPAC Name | boron;2-methylpropan-2-amine |
| InChI Key | GKFJEDWZQZKYHV-UHFFFAOYSA-N |
| Molecular Formula | C4H14BN |
Sulfanilic Acid, Anhydrous, ACS, 98-102%, Spectrum™ Chemical
CAS: 121-57-3 Molecular Formula: C6H7NO3S Molecular Weight (g/mol): 173.19 InChI Key: HVBSAKJJOYLTQU-UHFFFAOYSA-N IUPAC Name: 4-aminobenzene-1-sulfonic acid SMILES: NC1=CC=C(C=C1)S(O)(=O)=O
| CAS | 121-57-3 |
|---|---|
| Molecular Weight (g/mol) | 173.19 |
| SMILES | NC1=CC=C(C=C1)S(O)(=O)=O |
| IUPAC Name | 4-aminobenzene-1-sulfonic acid |
| InChI Key | HVBSAKJJOYLTQU-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO3S |
4-Mercaptobenzoic acid, 90%
CAS: 1074-36-8 Molecular Formula: C7H6O2S Molecular Weight (g/mol): 154.18 MDL Number: MFCD00016617 InChI Key: LMJXSOYPAOSIPZ-UHFFFAOYSA-N Synonym: 4-mercaptobenzoic acid,4-mercaptobenzoate,benzoic acid, 4-mercapto,4-mercapto-benzoic acid,4-mercapto benzoic acid,4-thiobenzoic acid,p-mercaptobenzoic acid,benzoic acid, p-mercapto,para-mercaptobenzoate,paracarboxythiophenol PubChem CID: 95738 IUPAC Name: 4-sulfanylbenzoic acid SMILES: OC(=O)C1=CC=C(S)C=C1
| PubChem CID | 95738 |
|---|---|
| CAS | 1074-36-8 |
| Molecular Weight (g/mol) | 154.18 |
| MDL Number | MFCD00016617 |
| SMILES | OC(=O)C1=CC=C(S)C=C1 |
| Synonym | 4-mercaptobenzoic acid,4-mercaptobenzoate,benzoic acid, 4-mercapto,4-mercapto-benzoic acid,4-mercapto benzoic acid,4-thiobenzoic acid,p-mercaptobenzoic acid,benzoic acid, p-mercapto,para-mercaptobenzoate,paracarboxythiophenol |
| IUPAC Name | 4-sulfanylbenzoic acid |
| InChI Key | LMJXSOYPAOSIPZ-UHFFFAOYSA-N |
| Molecular Formula | C7H6O2S |
12-Crown-4, 97%
CAS: 294-93-9 Molecular Formula: C8H16O4 Molecular Weight (g/mol): 176.21 MDL Number: MFCD00005103 InChI Key: XQQZRZQVBFHBHL-UHFFFAOYSA-N PubChem CID: 9269 ChEBI: CHEBI:32399 IUPAC Name: 1,4,7,10-tetraoxacyclododecane SMILES: C1COCCOCCOCCO1
| PubChem CID | 9269 |
|---|---|
| CAS | 294-93-9 |
| Molecular Weight (g/mol) | 176.21 |
| ChEBI | CHEBI:32399 |
| MDL Number | MFCD00005103 |
| SMILES | C1COCCOCCOCCO1 |
| IUPAC Name | 1,4,7,10-tetraoxacyclododecane |
| InChI Key | XQQZRZQVBFHBHL-UHFFFAOYSA-N |
| Molecular Formula | C8H16O4 |
2,6-Dimethoxybenzeneboronic acid, 97+%
CAS: 23112-96-1 Molecular Formula: C8H11BO4 Molecular Weight (g/mol): 181.982 MDL Number: MFCD01318987 InChI Key: BKWVXPCYDRURMK-UHFFFAOYSA-N Synonym: 2,6-dimethoxyphenyl boronic acid,2,6-dimethoxyphenylboronicacid,2,6-dimethoxybenzeneboronic acid,2,6-dimethoxyphenyl-boronic acid,2,6-dimethoxyphenyl boranediol,boronic acid, 2,6-dimethoxyphenyl,pubchem1825,acmc-1clhv,ksc201q0f,2,6-dimethoxy-phenylboronic acid PubChem CID: 2734343 IUPAC Name: (2,6-dimethoxyphenyl)boronic acid SMILES: B(C1=C(C=CC=C1OC)OC)(O)O
| PubChem CID | 2734343 |
|---|---|
| CAS | 23112-96-1 |
| Molecular Weight (g/mol) | 181.982 |
| MDL Number | MFCD01318987 |
| SMILES | B(C1=C(C=CC=C1OC)OC)(O)O |
| Synonym | 2,6-dimethoxyphenyl boronic acid,2,6-dimethoxyphenylboronicacid,2,6-dimethoxybenzeneboronic acid,2,6-dimethoxyphenyl-boronic acid,2,6-dimethoxyphenyl boranediol,boronic acid, 2,6-dimethoxyphenyl,pubchem1825,acmc-1clhv,ksc201q0f,2,6-dimethoxy-phenylboronic acid |
| IUPAC Name | (2,6-dimethoxyphenyl)boronic acid |
| InChI Key | BKWVXPCYDRURMK-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4 |
Isopropylboronic acid pinacol ester, 97%
CAS: 76347-13-2 Molecular Formula: C9H19BO2 Molecular Weight (g/mol): 170.059 MDL Number: MFCD05663856 InChI Key: MECCSFDHAVAAAW-UHFFFAOYSA-N Synonym: 2-isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-isopropylboronic acid, pinacol ester,2-isopropylboronic acid pinacol ester,isopropylboronic acid pinacol ester,4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane,1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-1-methylethyl,2-isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborole,2-isoproyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-methylethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane PubChem CID: 12727711 IUPAC Name: 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C(C)C
| PubChem CID | 12727711 |
|---|---|
| CAS | 76347-13-2 |
| Molecular Weight (g/mol) | 170.059 |
| MDL Number | MFCD05663856 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)C |
| Synonym | 2-isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-isopropylboronic acid, pinacol ester,2-isopropylboronic acid pinacol ester,isopropylboronic acid pinacol ester,4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane,1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-1-methylethyl,2-isopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborole,2-isoproyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-methylethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| IUPAC Name | 4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| InChI Key | MECCSFDHAVAAAW-UHFFFAOYSA-N |
| Molecular Formula | C9H19BO2 |
2-Benzyloxybenzeneboronic acid, 96%
CAS: 190661-29-1 Molecular Formula: C13H13BO3 Molecular Weight (g/mol): 228.054 MDL Number: MFCD01632206 InChI Key: MCAIDINWZOCYQK-UHFFFAOYSA-N Synonym: 2-benzyloxyphenylboronic acid,2-benzyloxy phenylboronic acid,2-benzyloxybenzeneboronic acid,2-benzyloxy phenyl boronic acid,2-benzyloxyphenyl boronic acid,2-benzyloxyphenylborornic acid,2-benzyloxy phenyl boranediol,o-benzyloxyphenylboronic acid,boronic acid, 2-phenylmethoxy phenyl PubChem CID: 2773253 IUPAC Name: (2-phenylmethoxyphenyl)boronic acid SMILES: B(C1=CC=CC=C1OCC2=CC=CC=C2)(O)O
| PubChem CID | 2773253 |
|---|---|
| CAS | 190661-29-1 |
| Molecular Weight (g/mol) | 228.054 |
| MDL Number | MFCD01632206 |
| SMILES | B(C1=CC=CC=C1OCC2=CC=CC=C2)(O)O |
| Synonym | 2-benzyloxyphenylboronic acid,2-benzyloxy phenylboronic acid,2-benzyloxybenzeneboronic acid,2-benzyloxy phenyl boronic acid,2-benzyloxyphenyl boronic acid,2-benzyloxyphenylborornic acid,2-benzyloxy phenyl boranediol,o-benzyloxyphenylboronic acid,boronic acid, 2-phenylmethoxy phenyl |
| IUPAC Name | (2-phenylmethoxyphenyl)boronic acid |
| InChI Key | MCAIDINWZOCYQK-UHFFFAOYSA-N |
| Molecular Formula | C13H13BO3 |
Phenylboronic acid, 98+%, may contain varying amounts of anhydride
CAS: 98-80-6 Molecular Formula: C6H7BO2 Molecular Weight (g/mol): 121.93 MDL Number: MFCD00002103 InChI Key: HXITXNWTGFUOAU-UHFFFAOYSA-N Synonym: benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 PubChem CID: 66827 ChEBI: CHEBI:44923 IUPAC Name: phenylboronic acid SMILES: OB(O)C1=CC=CC=C1
| PubChem CID | 66827 |
|---|---|
| CAS | 98-80-6 |
| Molecular Weight (g/mol) | 121.93 |
| ChEBI | CHEBI:44923 |
| MDL Number | MFCD00002103 |
| SMILES | OB(O)C1=CC=CC=C1 |
| Synonym | benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 |
| IUPAC Name | phenylboronic acid |
| InChI Key | HXITXNWTGFUOAU-UHFFFAOYSA-N |
| Molecular Formula | C6H7BO2 |
4-Aminobenzeneboronic acid hydrochloride, 97%
CAS: 80460-73-7 Molecular Formula: C6H9BClNO2 Molecular Weight (g/mol): 173.403 MDL Number: MFCD03001333 InChI Key: QBYGJJSFMOVYOA-UHFFFAOYSA-N Synonym: 4-aminophenylboronic acid hydrochloride,4-aminophenyl boronic acid hydrochloride,4-aminobenzeneboronic acid hydrochloride,4-aminophenylboronic acid hcl,4-boronoaniline hydrochloride,4-aminophenylboronic acid, hcl,boronic acid, 4-aminophenyl-, hydrochloride,pubchem1747,4-aminophenylboronicacidhydrochloride,ksc494e4p PubChem CID: 2734614 IUPAC Name: (4-aminophenyl)boronic acid;hydrochloride SMILES: B(C1=CC=C(C=C1)N)(O)O.Cl
| PubChem CID | 2734614 |
|---|---|
| CAS | 80460-73-7 |
| Molecular Weight (g/mol) | 173.403 |
| MDL Number | MFCD03001333 |
| SMILES | B(C1=CC=C(C=C1)N)(O)O.Cl |
| Synonym | 4-aminophenylboronic acid hydrochloride,4-aminophenyl boronic acid hydrochloride,4-aminobenzeneboronic acid hydrochloride,4-aminophenylboronic acid hcl,4-boronoaniline hydrochloride,4-aminophenylboronic acid, hcl,boronic acid, 4-aminophenyl-, hydrochloride,pubchem1747,4-aminophenylboronicacidhydrochloride,ksc494e4p |
| IUPAC Name | (4-aminophenyl)boronic acid;hydrochloride |
| InChI Key | QBYGJJSFMOVYOA-UHFFFAOYSA-N |
| Molecular Formula | C6H9BClNO2 |
3-Methoxycarbonylphenylboronic acid, 97%
CAS: 99769-19-4 Molecular Formula: C8H9BO4 Molecular Weight (g/mol): 179.97 MDL Number: MFCD02093046 InChI Key: ALTLCJHSJMGSLT-UHFFFAOYSA-N Synonym: 3-methoxycarbonyl phenylboronic acid,3-methoxycarbonylphenyl boronic acid,3-methoxycarbonyl phenyl boronic acid,3-methoxycarbonyl benzeneboronic acid,3-methoxycarbonylphenylbaronic acid,methyl 3-dihydroxyboranyl benzoate,m-methoxycarbonyl phenylboronic acid,3-carbomethoxy-phenylboronic acid PubChem CID: 2734714 IUPAC Name: (3-methoxycarbonylphenyl)boronic acid SMILES: COC(=O)C1=CC=CC(=C1)B(O)O
| PubChem CID | 2734714 |
|---|---|
| CAS | 99769-19-4 |
| Molecular Weight (g/mol) | 179.97 |
| MDL Number | MFCD02093046 |
| SMILES | COC(=O)C1=CC=CC(=C1)B(O)O |
| Synonym | 3-methoxycarbonyl phenylboronic acid,3-methoxycarbonylphenyl boronic acid,3-methoxycarbonyl phenyl boronic acid,3-methoxycarbonyl benzeneboronic acid,3-methoxycarbonylphenylbaronic acid,methyl 3-dihydroxyboranyl benzoate,m-methoxycarbonyl phenylboronic acid,3-carbomethoxy-phenylboronic acid |
| IUPAC Name | (3-methoxycarbonylphenyl)boronic acid |
| InChI Key | ALTLCJHSJMGSLT-UHFFFAOYSA-N |
| Molecular Formula | C8H9BO4 |
2,3-Dihydro-1-benzofuran-5-ylboronic acid, 95%, May contain varying amounts of anhydride, Thermo Scientific™
CAS: 227305-69-3 Molecular Formula: C8H9BO3 Molecular Weight (g/mol): 163.97 MDL Number: MFCD02681979 InChI Key: ZIXLJHSFAMVHPC-UHFFFAOYSA-N Synonym: 2,3-dihydrobenzofuran-5-boronic acid,2,3-dihydrobenzofuran-5-ylboronic acid,2,3-dihydrobenzofuran-5-yl boronic acid,2,3-dihydrobenzo b furan-5-boronic acid,2,3-dihydrobenzofuran-5-yl-5-boronic acid,boronic acid, 2,3-dihydro-5-benzofuranyl,2,3-dihydro-1-benzofuran-5-yl-boranediol,2,3-dihydro-1-benzofuran-5-yl boronic acid,pubchem7848,zlchem 1108 PubChem CID: 2773380 SMILES: OB(O)C1=CC=C2OCCC2=C1
| PubChem CID | 2773380 |
|---|---|
| CAS | 227305-69-3 |
| Molecular Weight (g/mol) | 163.97 |
| MDL Number | MFCD02681979 |
| SMILES | OB(O)C1=CC=C2OCCC2=C1 |
| Synonym | 2,3-dihydrobenzofuran-5-boronic acid,2,3-dihydrobenzofuran-5-ylboronic acid,2,3-dihydrobenzofuran-5-yl boronic acid,2,3-dihydrobenzo b furan-5-boronic acid,2,3-dihydrobenzofuran-5-yl-5-boronic acid,boronic acid, 2,3-dihydro-5-benzofuranyl,2,3-dihydro-1-benzofuran-5-yl-boranediol,2,3-dihydro-1-benzofuran-5-yl boronic acid,pubchem7848,zlchem 1108 |
| InChI Key | ZIXLJHSFAMVHPC-UHFFFAOYSA-N |
| Molecular Formula | C8H9BO3 |
Biphenyl-4,4'-diboronic acid, 94%
CAS: 4151-80-8 Molecular Formula: C12H12B2O4 Molecular Weight (g/mol): 241.84 MDL Number: MFCD00151795 InChI Key: SLHKDOGTVUCXKX-UHFFFAOYSA-N Synonym: 4,4'-biphenyldiboronic acid,1,1'-biphenyl-4,4'-diyldiboronic acid,biphenyl-4,4'-diboronic acid,4-4-boronophenyl phenyl boronic acid,biphenyl-4,4'-diyldiboronic acid,pubchem5324,acmc-1apw8,4,4'-biphenyldiboric acid,4,4-biphenyldiboronic acid,4,4'-diboronobiphenyl PubChem CID: 2734608 IUPAC Name: [4-(4-boronophenyl)phenyl]boronic acid SMILES: OB(O)C1=CC=C(C=C1)C1=CC=C(C=C1)B(O)O
| PubChem CID | 2734608 |
|---|---|
| CAS | 4151-80-8 |
| Molecular Weight (g/mol) | 241.84 |
| MDL Number | MFCD00151795 |
| SMILES | OB(O)C1=CC=C(C=C1)C1=CC=C(C=C1)B(O)O |
| Synonym | 4,4'-biphenyldiboronic acid,1,1'-biphenyl-4,4'-diyldiboronic acid,biphenyl-4,4'-diboronic acid,4-4-boronophenyl phenyl boronic acid,biphenyl-4,4'-diyldiboronic acid,pubchem5324,acmc-1apw8,4,4'-biphenyldiboric acid,4,4-biphenyldiboronic acid,4,4'-diboronobiphenyl |
| IUPAC Name | [4-(4-boronophenyl)phenyl]boronic acid |
| InChI Key | SLHKDOGTVUCXKX-UHFFFAOYSA-N |
| Molecular Formula | C12H12B2O4 |
3-Fluoropyridine-4-boronic acid, 98%
CAS: 458532-97-3 Molecular Formula: C5H5BFNO2 Molecular Weight (g/mol): 140.908 MDL Number: MFCD03788558 InChI Key: QUHSESYLMZVXCN-UHFFFAOYSA-N Synonym: 3-fluoropyridine-4-boronic acid,3-fluoropyridin-4-yl boronic acid,3-fluoropyridin-4-yl-4-boronic acid,3-fluoro-4-pyridyl boronic acid,boronic acid, 3-fluoro-4-pyridinyl,3-fluoro-4-pyridylboronic acid,3-fluoropyridin-4-yl boranediol,3-fluoro-4-pyridineboronic acid,3-fluoropyridine-4-boronicacid PubChem CID: 2779353 IUPAC Name: (3-fluoropyridin-4-yl)boronic acid SMILES: B(C1=C(C=NC=C1)F)(O)O
| PubChem CID | 2779353 |
|---|---|
| CAS | 458532-97-3 |
| Molecular Weight (g/mol) | 140.908 |
| MDL Number | MFCD03788558 |
| SMILES | B(C1=C(C=NC=C1)F)(O)O |
| Synonym | 3-fluoropyridine-4-boronic acid,3-fluoropyridin-4-yl boronic acid,3-fluoropyridin-4-yl-4-boronic acid,3-fluoro-4-pyridyl boronic acid,boronic acid, 3-fluoro-4-pyridinyl,3-fluoro-4-pyridylboronic acid,3-fluoropyridin-4-yl boranediol,3-fluoro-4-pyridineboronic acid,3-fluoropyridine-4-boronicacid |
| IUPAC Name | (3-fluoropyridin-4-yl)boronic acid |
| InChI Key | QUHSESYLMZVXCN-UHFFFAOYSA-N |
| Molecular Formula | C5H5BFNO2 |